C8H9BO4 — CID 141312806
3,4-dihydro-1,2-benzodioxin-3-ylboronic acid (PubChem CID 141312806) has the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. Its IUPAC name is 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid.
| Compound Name | 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid |
|---|---|
| PubChem CID | 141312806 |
| Molecular Formula | C8H9BO4 |
| Molecular Weight | 179.97 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid |
| SMILES | OB(O)C1Cc2ccccc2OO1 |
| InChI | InChI=1S/C8H9BO4/c10-9(11)8-5-6-3-1-2-4-7(6)12-13-8/h1-4,8,10-11H,5H2 |
| InChIKey | YMNAYKDHUISVDB-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.97 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|