3,4-dihydro-1,2-benzodioxin-3-ylboronic acid

C8H9BO4 — CID 141312806

IUPAC3,4-dihydro-1,2-benzodioxin-3-ylboronic acid
SMILESOB(O)C1Cc2ccccc2OO1
InChIInChI=1S/C8H9BO4/c10-9(11)8-5-6-3-1-2-4-7(6)12-13-8/h1-4,8,10-11H,5H2
InChIKeyYMNAYKDHUISVDB-UHFFFAOYSA-N
MW179.97 g/mol
LogP-0.07
Rot. Bonds1

About 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid

3,4-dihydro-1,2-benzodioxin-3-ylboronic acid (PubChem CID 141312806) has the molecular formula C8H9BO4 and a molecular weight of 179.97 g/mol. Its IUPAC name is 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid.

Molecular Properties

Compound Name3,4-dihydro-1,2-benzodioxin-3-ylboronic acid
PubChem CID141312806
Molecular FormulaC8H9BO4
Molecular Weight179.97 g/mol
Exact Mass180.06
IUPAC Name3,4-dihydro-1,2-benzodioxin-3-ylboronic acid
SMILESOB(O)C1Cc2ccccc2OO1
InChIInChI=1S/C8H9BO4/c10-9(11)8-5-6-3-1-2-4-7(6)12-13-8/h1-4,8,10-11H,5H2
InChIKeyYMNAYKDHUISVDB-UHFFFAOYSA-N
XLogP-0.07
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.97
LogP ≤ 5-0.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid?
The IUPAC name of 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid (CID 141312806) is 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid.
What is the SMILES notation for 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid?
The canonical SMILES for 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid is OB(O)C1Cc2ccccc2OO1.
What is the InChIKey of 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid?
The InChIKey is YMNAYKDHUISVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BO4/c10-9(11)8-5-6-3-1-2-4-7(6)12-13-8/h1-4,8,10-11H,5H2.
What are the key properties of 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid?
3,4-dihydro-1,2-benzodioxin-3-ylboronic acid has a molecular weight of 179.97 g/mol, XLogP of -0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-1,2-benzodioxin-3-ylboronic acid is sourced from PubChem (CID 141312806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).