C11H15NO2 — CID 155711300
2-[[(3S)-3,4-dihydro-2H-chromen-3-yl]amino]ethanol (PubChem CID 155711300) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-[[(3S)-3,4-dihydro-2H-chromen-3-yl]amino]ethanol.
| Compound Name | 2-[[(3S)-3,4-dihydro-2H-chromen-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 155711300 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-[[(3S)-3,4-dihydro-2H-chromen-3-yl]amino]ethanol |
| SMILES | OCCN[C@@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C11H15NO2/c13-6-5-12-10-7-9-3-1-2-4-11(9)14-8-10/h1-4,10,12-13H,5-8H2/t10-/m0/s1 |
| InChIKey | WLCVSUPZJBHOBN-JTQLQIEISA-N |
| XLogP | 0.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |