C9H10FNO — CID 141437976
N-fluoro-3,4-dihydro-2H-chromen-3-amine (PubChem CID 141437976) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is N-fluoro-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | N-fluoro-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 141437976 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | N-fluoro-3,4-dihydro-2H-chromen-3-amine |
| SMILES | FNC1COc2ccccc2C1 |
| InChI | InChI=1S/C9H10FNO/c10-11-8-5-7-3-1-2-4-9(7)12-6-8/h1-4,8,11H,5-6H2 |
| InChIKey | IINYFPZRFGUKRR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|