C14H19NOS2 — CID 42213064
(3S)-N-(1,4-dithiepan-6-yl)-3,4-dihydro-2H-chromen-3-amine (PubChem CID 42213064) has the molecular formula C14H19NOS2 and a molecular weight of 281.45 g/mol. Its IUPAC name is (3S)-N-(1,4-dithiepan-6-yl)-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | (3S)-N-(1,4-dithiepan-6-yl)-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 42213064 |
| Molecular Formula | C14H19NOS2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (3S)-N-(1,4-dithiepan-6-yl)-3,4-dihydro-2H-chromen-3-amine |
| SMILES | c1ccc2c(c1)C[C@H](NC1CSCCSC1)CO2 |
| InChI | InChI=1S/C14H19NOS2/c1-2-4-14-11(3-1)7-12(8-16-14)15-13-9-17-5-6-18-10-13/h1-4,12-13,15H,5-10H2/t12-/m0/s1 |
| InChIKey | AVCAVKWPQNKMHX-LBPRGKRZSA-N |
| XLogP | 2.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |