C11H15NO2 — CID 126985805
N-ethoxy-3,4-dihydro-2H-chromen-3-amine (PubChem CID 126985805) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-ethoxy-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | N-ethoxy-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 126985805 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-ethoxy-3,4-dihydro-2H-chromen-3-amine |
| SMILES | CCONC1COc2ccccc2C1 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-12-10-7-9-5-3-4-6-11(9)13-8-10/h3-6,10,12H,2,7-8H2,1H3 |
| InChIKey | RNSLWDDBIMIYTM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|