C19H22N2O2 — CID 92713528
1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 92713528) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 92713528 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N[C@H]2COc3ccccc3C2)c(C)c1 |
| InChI | InChI=1S/C19H22N2O2/c1-12-8-13(2)18(14(3)9-12)21-19(22)20-16-10-15-6-4-5-7-17(15)23-11-16/h4-9,16H,10-11H2,1-3H3,(H2,20,21,22)/t16-/m1/s1 |
| InChIKey | YLYRJTMSNQEXON-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |