C18H20N2O2 — CID 92713540
1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-(3-ethylphenyl)urea (PubChem CID 92713540) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-(3-ethylphenyl)urea.
| Compound Name | 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-(3-ethylphenyl)urea |
|---|---|
| PubChem CID | 92713540 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-[(3R)-3,4-dihydro-2H-chromen-3-yl]-3-(3-ethylphenyl)urea |
| SMILES | CCc1cccc(NC(=O)N[C@H]2COc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H20N2O2/c1-2-13-6-5-8-15(10-13)19-18(21)20-16-11-14-7-3-4-9-17(14)22-12-16/h3-10,16H,2,11-12H2,1H3,(H2,19,20,21)/t16-/m1/s1 |
| InChIKey | VNYYHFYLEJZRID-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |