C21H25N3O2 — CID 22580866
1-(3,4-dihydro-2H-chromen-3-yl)-3-[4-(pyrrolidin-1-ylmethyl)phenyl]urea (PubChem CID 22580866) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-3-yl)-3-[4-(pyrrolidin-1-ylmethyl)phenyl]urea.
| Compound Name | 1-(3,4-dihydro-2H-chromen-3-yl)-3-[4-(pyrrolidin-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 22580866 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-3-yl)-3-[4-(pyrrolidin-1-ylmethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(CN2CCCC2)cc1)NC1COc2ccccc2C1 |
| InChI | InChI=1S/C21H25N3O2/c25-21(23-19-13-17-5-1-2-6-20(17)26-15-19)22-18-9-7-16(8-10-18)14-24-11-3-4-12-24/h1-2,5-10,19H,3-4,11-15H2,(H2,22,23,25) |
| InChIKey | XQXVSEXNBKSJPP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |