C24H32N4O2 — CID 92765158
1-[3-(4-benzylpiperazin-1-yl)propyl]-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]urea (PubChem CID 92765158) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]urea.
| Compound Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]urea |
|---|---|
| PubChem CID | 92765158 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]urea |
| SMILES | O=C(NCCCN1CCN(Cc2ccccc2)CC1)N[C@@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C24H32N4O2/c29-24(26-22-17-21-9-4-5-10-23(21)30-19-22)25-11-6-12-27-13-15-28(16-14-27)18-20-7-2-1-3-8-20/h1-5,7-10,22H,6,11-19H2,(H2,25,26,29)/t22-/m0/s1 |
| InChIKey | ZKIDMGXOQJCIML-QFIPXVFZSA-N |
| XLogP | 2.50 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|