C16H14F2N2O2 — CID 92713549
1-(3,4-difluorophenyl)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]urea (PubChem CID 92713549) has the molecular formula C16H14F2N2O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]urea |
|---|---|
| PubChem CID | 92713549 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(3S)-3,4-dihydro-2H-chromen-3-yl]urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)N[C@@H]1COc2ccccc2C1 |
| InChI | InChI=1S/C16H14F2N2O2/c17-13-6-5-11(8-14(13)18)19-16(21)20-12-7-10-3-1-2-4-15(10)22-9-12/h1-6,8,12H,7,9H2,(H2,19,20,21)/t12-/m0/s1 |
| InChIKey | IRMTYVGUSOPZEG-LBPRGKRZSA-N |
| XLogP | 3.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |