C19H20N2O4 — CID 22580936
1-(3-acetylphenyl)-3-(6-methoxy-3,4-dihydro-2H-chromen-3-yl)urea (PubChem CID 22580936) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-(6-methoxy-3,4-dihydro-2H-chromen-3-yl)urea.
| Compound Name | 1-(3-acetylphenyl)-3-(6-methoxy-3,4-dihydro-2H-chromen-3-yl)urea |
|---|---|
| PubChem CID | 22580936 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-(3-acetylphenyl)-3-(6-methoxy-3,4-dihydro-2H-chromen-3-yl)urea |
| SMILES | COc1ccc2c(c1)CC(NC(=O)Nc1cccc(C(C)=O)c1)CO2 |
| InChI | InChI=1S/C19H20N2O4/c1-12(22)13-4-3-5-15(8-13)20-19(23)21-16-9-14-10-17(24-2)6-7-18(14)25-11-16/h3-8,10,16H,9,11H2,1-2H3,(H2,20,21,23) |
| InChIKey | LWEWDJOFSLXQCH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |