C10H13NO3 — CID 70091861
2-(2,3-dihydro-1,4-benzodioxin-3-ylamino)ethanol (PubChem CID 70091861) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-ylamino)ethanol.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylamino)ethanol |
|---|---|
| PubChem CID | 70091861 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylamino)ethanol |
| SMILES | OCCNC1COc2ccccc2O1 |
| InChI | InChI=1S/C10H13NO3/c12-6-5-11-10-7-13-8-3-1-2-4-9(8)14-10/h1-4,10-12H,5-7H2 |
| InChIKey | UNIPDBSRDVFGBK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |