C9H11NO2 — CID 94841715
(3S)-N-methyl-2,3-dihydro-1,4-benzodioxin-3-amine (PubChem CID 94841715) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (3S)-N-methyl-2,3-dihydro-1,4-benzodioxin-3-amine.
| Compound Name | (3S)-N-methyl-2,3-dihydro-1,4-benzodioxin-3-amine |
|---|---|
| PubChem CID | 94841715 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (3S)-N-methyl-2,3-dihydro-1,4-benzodioxin-3-amine |
| SMILES | CN[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C9H11NO2/c1-10-9-6-11-7-4-2-3-5-8(7)12-9/h2-5,9-10H,6H2,1H3/t9-/m0/s1 |
| InChIKey | SQLDBPQHRZBKDH-VIFPVBQESA-N |
| XLogP | 1.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |