C10H10O3 — CID 12736709
(3R)-3-[(2S)-oxiran-2-yl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 12736709) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (3R)-3-[(2S)-oxiran-2-yl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | (3R)-3-[(2S)-oxiran-2-yl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 12736709 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (3R)-3-[(2S)-oxiran-2-yl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | c1ccc2c(c1)OC[C@H]([C@@H]1CO1)O2 |
| InChI | InChI=1S/C10H10O3/c1-2-4-8-7(3-1)11-6-10(13-8)9-5-12-9/h1-4,9-10H,5-6H2/t9-,10+/m0/s1 |
| InChIKey | LDWQUOIUYGBUPN-VHSXEESVSA-N |
| XLogP | 1.23 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|