C9H7NO2 — CID 2735839
2,3-dihydro-1,4-benzodioxine-3-carbonitrile (PubChem CID 2735839) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine-3-carbonitrile.
| Compound Name | 2,3-dihydro-1,4-benzodioxine-3-carbonitrile |
|---|---|
| PubChem CID | 2735839 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine-3-carbonitrile |
| SMILES | N#CC1COc2ccccc2O1 |
| InChI | InChI=1S/C9H7NO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,6H2 |
| InChIKey | DNLJHDDOVWQQEW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |