C12H15N2O2+ — CID 7335860
2-cyanoethyl-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]azanium (PubChem CID 7335860) has the molecular formula C12H15N2O2+ and a molecular weight of 219.26 g/mol. Its IUPAC name is 2-cyanoethyl-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]azanium.
| Compound Name | 2-cyanoethyl-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]azanium |
|---|---|
| PubChem CID | 7335860 |
| Molecular Formula | C12H15N2O2+ |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-cyanoethyl-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]azanium |
| SMILES | N#CCC[NH2+]C[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C12H14N2O2/c13-6-3-7-14-8-10-9-15-11-4-1-2-5-12(11)16-10/h1-2,4-5,10,14H,3,7-9H2/p+1/t10-/m1/s1 |
| InChIKey | HDZVEVLDKLYESK-SNVBAGLBSA-O |
| XLogP | 0.30 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|