C18H22NO2+ — CID 7101122
[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl-(3-phenylpropyl)azanium (PubChem CID 7101122) has the molecular formula C18H22NO2+ and a molecular weight of 284.38 g/mol. Its IUPAC name is [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl-(3-phenylpropyl)azanium.
| Compound Name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl-(3-phenylpropyl)azanium |
|---|---|
| PubChem CID | 7101122 |
| Molecular Formula | C18H22NO2+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl-(3-phenylpropyl)azanium |
| SMILES | c1ccc(CCC[NH2+]C[C@H]2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-2-7-15(8-3-1)9-6-12-19-13-16-14-20-17-10-4-5-11-18(17)21-16/h1-5,7-8,10-11,16,19H,6,9,12-14H2/p+1/t16-/m0/s1 |
| InChIKey | CVAPBKKAWGUIRI-INIZCTEOSA-O |
| XLogP | 2.02 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|