C9H10N2O2S — CID 90944583
2,3-dihydro-1,4-benzodioxin-3-ylthiourea (PubChem CID 90944583) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-3-ylthiourea.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-3-ylthiourea |
|---|---|
| PubChem CID | 90944583 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-ylthiourea |
| SMILES | NC(=S)NC1COc2ccccc2O1 |
| InChI | InChI=1S/C9H10N2O2S/c10-9(14)11-8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2,(H3,10,11,14) |
| InChIKey | HKADZLGEEZZUHQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|