C9H10N2O3 — CID 7210185
(3S)-N'-hydroxy-2,3-dihydro-1,4-benzodioxine-3-carboximidamide (PubChem CID 7210185) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is (3S)-N'-hydroxy-2,3-dihydro-1,4-benzodioxine-3-carboximidamide.
| Compound Name | (3S)-N'-hydroxy-2,3-dihydro-1,4-benzodioxine-3-carboximidamide |
|---|---|
| PubChem CID | 7210185 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (3S)-N'-hydroxy-2,3-dihydro-1,4-benzodioxine-3-carboximidamide |
| SMILES | NC(=NO)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C9H10N2O3/c10-9(11-12)8-5-13-6-3-1-2-4-7(6)14-8/h1-4,8,12H,5H2,(H2,10,11)/t8-/m1/s1 |
| InChIKey | AINNARSDQRBELY-MRVPVSSYSA-N |
| XLogP | 0.57 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|