C13H18N2O2 — CID 65352140
N'-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxine-3-carboximidamide (PubChem CID 65352140) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N'-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxine-3-carboximidamide.
| Compound Name | N'-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxine-3-carboximidamide |
|---|---|
| PubChem CID | 65352140 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N'-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxine-3-carboximidamide |
| SMILES | CC(C)C/N=C(\N)C1COc2ccccc2O1 |
| InChI | InChI=1S/C13H18N2O2/c1-9(2)7-15-13(14)12-8-16-10-5-3-4-6-11(10)17-12/h3-6,9,12H,7-8H2,1-2H3,(H2,14,15) |
| InChIKey | KOMQPQWUGFQFTQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|