C10H13NO3 — CID 43151123
3-(2-hydroxyethylamino)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 43151123) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(2-hydroxyethylamino)-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 3-(2-hydroxyethylamino)-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 43151123 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-(2-hydroxyethylamino)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | OCCNC1COc2cc(O)ccc21 |
| InChI | InChI=1S/C10H13NO3/c12-4-3-11-9-6-14-10-5-7(13)1-2-8(9)10/h1-2,5,9,11-13H,3-4,6H2 |
| InChIKey | MYBMJOMBBSMRGV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |