C13H19NO2S — CID 114247835
3-(3-ethylsulfanylpropylamino)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 114247835) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-(3-ethylsulfanylpropylamino)-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 3-(3-ethylsulfanylpropylamino)-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 114247835 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-(3-ethylsulfanylpropylamino)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | CCSCCCNC1COc2cc(O)ccc21 |
| InChI | InChI=1S/C13H19NO2S/c1-2-17-7-3-6-14-12-9-16-13-8-10(15)4-5-11(12)13/h4-5,8,12,14-15H,2-3,6-7,9H2,1H3 |
| InChIKey | MKYKPHXSPHCMPG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|