C15H12O2 — CID 155934792
2,17-dioxatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaene (PubChem CID 155934792) has the molecular formula C15H12O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2,17-dioxatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaene.
| Compound Name | 2,17-dioxatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaene |
|---|---|
| PubChem CID | 155934792 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2,17-dioxatetracyclo[8.6.1.03,8.011,16]heptadeca-3,5,7,11,13,15-hexaene |
| SMILES | c1ccc2c(c1)CC1OC(O2)c2ccccc21 |
| InChI | InChI=1S/C15H12O2/c1-4-8-13-10(5-1)9-14-11-6-2-3-7-12(11)15(16-13)17-14/h1-8,14-15H,9H2 |
| InChIKey | VSFPDTRWYKBQJN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |