C15H12O3 — CID 139180489
(1S,9R,16S)-8,17-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-16-ol (PubChem CID 139180489) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is (1S,9R,16S)-8,17-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-16-ol.
| Compound Name | (1S,9R,16S)-8,17-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-16-ol |
|---|---|
| PubChem CID | 139180489 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (1S,9R,16S)-8,17-dioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-16-ol |
| SMILES | O[C@H]1c2ccccc2[C@H]2Oc3ccccc3[C@@H]1O2 |
| InChI | InChI=1S/C15H12O3/c16-13-9-5-1-2-6-10(9)15-17-12-8-4-3-7-11(12)14(13)18-15/h1-8,13-16H/t13-,14-,15-/m0/s1 |
| InChIKey | AKMBOILTQQLWBS-KKUMJFAQSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |