C14H8Br2O3 — CID 1226589
(1S,9R)-4,12-dibromo-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 1226589) has the molecular formula C14H8Br2O3 and a molecular weight of 384.02 g/mol. Its IUPAC name is (1S,9R)-4,12-dibromo-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | (1S,9R)-4,12-dibromo-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 1226589 |
| Molecular Formula | C14H8Br2O3 |
| Molecular Weight | 384.02 g/mol |
| Exact Mass | 381.88 |
| IUPAC Name | (1S,9R)-4,12-dibromo-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | Brc1ccc2c(c1)[C@@H]1Oc3ccc(Br)cc3[C@@H](O2)O1 |
| InChI | InChI=1S/C14H8Br2O3/c15-7-1-3-11-9(5-7)13-18-12-4-2-8(16)6-10(12)14(17-11)19-13/h1-6,13-14H/t13-,14+ |
| InChIKey | WFDANGIGTVZSIQ-OKILXGFUSA-N |
| XLogP | 4.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.02 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |