C16H12Br2O3 — CID 66829012
4,12-dibromo-6,14-dimethyl-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 66829012) has the molecular formula C16H12Br2O3 and a molecular weight of 412.08 g/mol. Its IUPAC name is 4,12-dibromo-6,14-dimethyl-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | 4,12-dibromo-6,14-dimethyl-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 66829012 |
| Molecular Formula | C16H12Br2O3 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.92 |
| IUPAC Name | 4,12-dibromo-6,14-dimethyl-8,16,17-trioxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | Cc1cc(Br)cc2c1OC1OC2Oc2c(C)cc(Br)cc21 |
| InChI | InChI=1S/C16H12Br2O3/c1-7-3-9(17)5-11-13(7)19-16-12-6-10(18)4-8(2)14(12)20-15(11)21-16/h3-6,15-16H,1-2H3 |
| InChIKey | XUCFXDFZAMPISG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |