C15H13Br2NO — CID 104947173
(4S)-6-bromo-2-(4-bromophenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104947173) has the molecular formula C15H13Br2NO and a molecular weight of 383.08 g/mol. Its IUPAC name is (4S)-6-bromo-2-(4-bromophenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-6-bromo-2-(4-bromophenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104947173 |
| Molecular Formula | C15H13Br2NO |
| Molecular Weight | 383.08 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | (4S)-6-bromo-2-(4-bromophenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@H]1CC(c2ccc(Br)cc2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H13Br2NO/c16-10-3-1-9(2-4-10)15-8-13(18)12-7-11(17)5-6-14(12)19-15/h1-7,13,15H,8,18H2/t13-,15?/m0/s1 |
| InChIKey | YKWFOSLIUYXDIO-CFMCSPIPSA-N |
| XLogP | 4.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.08 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |