C13H11Br2NOS — CID 112739916
6-bromo-2-(4-bromothiophen-3-yl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 112739916) has the molecular formula C13H11Br2NOS and a molecular weight of 389.11 g/mol. Its IUPAC name is 6-bromo-2-(4-bromothiophen-3-yl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-bromo-2-(4-bromothiophen-3-yl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 112739916 |
| Molecular Formula | C13H11Br2NOS |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 386.89 |
| IUPAC Name | 6-bromo-2-(4-bromothiophen-3-yl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1CC(c2cscc2Br)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H11Br2NOS/c14-7-1-2-12-8(3-7)11(16)4-13(17-12)9-5-18-6-10(9)15/h1-3,5-6,11,13H,4,16H2 |
| InChIKey | CYLVWLYRLMHOHO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |