C15H12BrF2NO — CID 106534741
6-bromo-2-(3,5-difluorophenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 106534741) has the molecular formula C15H12BrF2NO and a molecular weight of 340.17 g/mol. Its IUPAC name is 6-bromo-2-(3,5-difluorophenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-bromo-2-(3,5-difluorophenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 106534741 |
| Molecular Formula | C15H12BrF2NO |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 6-bromo-2-(3,5-difluorophenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | NC1CC(c2cc(F)cc(F)c2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H12BrF2NO/c16-9-1-2-14-12(5-9)13(19)7-15(20-14)8-3-10(17)6-11(18)4-8/h1-6,13,15H,7,19H2 |
| InChIKey | DZVIHVITOMRDMY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |