C7H4BrFO2 — CID 143412391
5-bromo-2-fluoro-1,3-benzodioxole (PubChem CID 143412391) has the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. Its IUPAC name is 5-bromo-2-fluoro-1,3-benzodioxole.
| Compound Name | 5-bromo-2-fluoro-1,3-benzodioxole |
|---|---|
| PubChem CID | 143412391 |
| Molecular Formula | C7H4BrFO2 |
| Molecular Weight | 219.01 g/mol |
| Exact Mass | 217.94 |
| IUPAC Name | 5-bromo-2-fluoro-1,3-benzodioxole |
| SMILES | FC1Oc2ccc(Br)cc2O1 |
| InChI | InChI=1S/C7H4BrFO2/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3,7H |
| InChIKey | RHOJAWVNQNPROU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.01 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |