C9H7BrO3 — CID 117046659
6-bromo-2,3-dihydro-1,4-benzodioxine-3-carbaldehyde (PubChem CID 117046659) has the molecular formula C9H7BrO3 and a molecular weight of 243.06 g/mol. Its IUPAC name is 6-bromo-2,3-dihydro-1,4-benzodioxine-3-carbaldehyde.
| Compound Name | 6-bromo-2,3-dihydro-1,4-benzodioxine-3-carbaldehyde |
|---|---|
| PubChem CID | 117046659 |
| Molecular Formula | C9H7BrO3 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 6-bromo-2,3-dihydro-1,4-benzodioxine-3-carbaldehyde |
| SMILES | O=CC1COc2ccc(Br)cc2O1 |
| InChI | InChI=1S/C9H7BrO3/c10-6-1-2-8-9(3-6)13-7(4-11)5-12-8/h1-4,7H,5H2 |
| InChIKey | PGXSKJJBJDLIRY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|