C8H7BrO2 — CID 137498464
6-bromo-2,2,3,3-tetradeuterio-1,4-benzodioxine (PubChem CID 137498464) has the molecular formula C8H7BrO2 and a molecular weight of 219.07 g/mol. Its IUPAC name is 6-bromo-2,2,3,3-tetradeuterio-1,4-benzodioxine.
| Compound Name | 6-bromo-2,2,3,3-tetradeuterio-1,4-benzodioxine |
|---|---|
| PubChem CID | 137498464 |
| Molecular Formula | C8H7BrO2 |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 6-bromo-2,2,3,3-tetradeuterio-1,4-benzodioxine |
| SMILES | [2H]C1([2H])Oc2ccc(Br)cc2OC1([2H])[2H] |
| InChI | InChI=1S/C8H7BrO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2/i3D2,4D2 |
| InChIKey | LFCURAJBHDNUNG-KHORGVISSA-N |
| XLogP | 2.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |