C16H9BrO4 — CID 28888936
1,3-benzodioxol-5-yl-(5-bromo-1-benzofuran-2-yl)methanone (PubChem CID 28888936) has the molecular formula C16H9BrO4 and a molecular weight of 345.15 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(5-bromo-1-benzofuran-2-yl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl-(5-bromo-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 28888936 |
| Molecular Formula | C16H9BrO4 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(5-bromo-1-benzofuran-2-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C16H9BrO4/c17-11-2-4-12-10(5-11)7-15(21-12)16(18)9-1-3-13-14(6-9)20-8-19-13/h1-7H,8H2 |
| InChIKey | XOWDWEDDNUUOQB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |