C14H9NO4 — CID 47411580
furo[2,3-f][1,3]benzodioxol-6-yl(1H-pyrrol-2-yl)methanone (PubChem CID 47411580) has the molecular formula C14H9NO4 and a molecular weight of 255.23 g/mol. Its IUPAC name is furo[2,3-f][1,3]benzodioxol-6-yl(1H-pyrrol-2-yl)methanone.
| Compound Name | furo[2,3-f][1,3]benzodioxol-6-yl(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 47411580 |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | furo[2,3-f][1,3]benzodioxol-6-yl(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc[nH]1)c1cc2cc3c(cc2o1)OCO3 |
| InChI | InChI=1S/C14H9NO4/c16-14(9-2-1-3-15-9)13-5-8-4-11-12(18-7-17-11)6-10(8)19-13/h1-6,15H,7H2 |
| InChIKey | CXMYSIWRIRRIQV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |