C17H12O4 — CID 60587967
furo[2,3-f][1,3]benzodioxol-6-yl-(4-methylphenyl)methanone (PubChem CID 60587967) has the molecular formula C17H12O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is furo[2,3-f][1,3]benzodioxol-6-yl-(4-methylphenyl)methanone.
| Compound Name | furo[2,3-f][1,3]benzodioxol-6-yl-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 60587967 |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | furo[2,3-f][1,3]benzodioxol-6-yl-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc3cc4c(cc3o2)OCO4)cc1 |
| InChI | InChI=1S/C17H12O4/c1-10-2-4-11(5-3-10)17(18)16-7-12-6-14-15(20-9-19-14)8-13(12)21-16/h2-8H,9H2,1H3 |
| InChIKey | FVMIBHJIPOQMGV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |