C18H14O5 — CID 60587932
(4-ethoxyphenyl)-furo[2,3-f][1,3]benzodioxol-6-ylmethanone (PubChem CID 60587932) has the molecular formula C18H14O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is (4-ethoxyphenyl)-furo[2,3-f][1,3]benzodioxol-6-ylmethanone.
| Compound Name | (4-ethoxyphenyl)-furo[2,3-f][1,3]benzodioxol-6-ylmethanone |
|---|---|
| PubChem CID | 60587932 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (4-ethoxyphenyl)-furo[2,3-f][1,3]benzodioxol-6-ylmethanone |
| SMILES | CCOc1ccc(C(=O)c2cc3cc4c(cc3o2)OCO4)cc1 |
| InChI | InChI=1S/C18H14O5/c1-2-20-13-5-3-11(4-6-13)18(19)17-8-12-7-15-16(22-10-21-15)9-14(12)23-17/h3-9H,2,10H2,1H3 |
| InChIKey | QRNZFPOMDMTYPC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |