C15H17NO5 — CID 71577026
3-(dimethylamino)propyl furo[2,3-f][1,3]benzodioxole-6-carboxylate (PubChem CID 71577026) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-(dimethylamino)propyl furo[2,3-f][1,3]benzodioxole-6-carboxylate.
| Compound Name | 3-(dimethylamino)propyl furo[2,3-f][1,3]benzodioxole-6-carboxylate |
|---|---|
| PubChem CID | 71577026 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-(dimethylamino)propyl furo[2,3-f][1,3]benzodioxole-6-carboxylate |
| SMILES | CN(C)CCCOC(=O)c1cc2cc3c(cc2o1)OCO3 |
| InChI | InChI=1S/C15H17NO5/c1-16(2)4-3-5-18-15(17)14-7-10-6-12-13(20-9-19-12)8-11(10)21-14/h6-8H,3-5,9H2,1-2H3 |
| InChIKey | GYISDJSTELSWJP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|