C11H9NO4 — CID 139623375
N-methylfuro[2,3-f][1,3]benzodioxole-6-carboxamide (PubChem CID 139623375) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is N-methylfuro[2,3-f][1,3]benzodioxole-6-carboxamide.
| Compound Name | N-methylfuro[2,3-f][1,3]benzodioxole-6-carboxamide |
|---|---|
| PubChem CID | 139623375 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-methylfuro[2,3-f][1,3]benzodioxole-6-carboxamide |
| SMILES | CNC(=O)c1cc2cc3c(cc2o1)OCO3 |
| InChI | InChI=1S/C11H9NO4/c1-12-11(13)10-3-6-2-8-9(15-5-14-8)4-7(6)16-10/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | UVJXSCAIXAGJFE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |