C16H12O4 — CID 123388809
4-(furo[2,3-f][1,3]benzodioxol-6-ylmethyl)phenol (PubChem CID 123388809) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 4-(furo[2,3-f][1,3]benzodioxol-6-ylmethyl)phenol.
| Compound Name | 4-(furo[2,3-f][1,3]benzodioxol-6-ylmethyl)phenol |
|---|---|
| PubChem CID | 123388809 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-(furo[2,3-f][1,3]benzodioxol-6-ylmethyl)phenol |
| SMILES | Oc1ccc(Cc2cc3cc4c(cc3o2)OCO4)cc1 |
| InChI | InChI=1S/C16H12O4/c17-12-3-1-10(2-4-12)5-13-6-11-7-15-16(19-9-18-15)8-14(11)20-13/h1-4,6-8,17H,5,9H2 |
| InChIKey | CJCRSOCZFXLHNF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |