C14H11FO3 — CID 102584547
6-[(4-fluorophenyl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 102584547) has the molecular formula C14H11FO3 and a molecular weight of 246.24 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(4-fluorophenyl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 102584547 |
| Molecular Formula | C14H11FO3 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1Cc1ccc(F)cc1)OCO2 |
| InChI | InChI=1S/C14H11FO3/c15-11-3-1-9(2-4-11)5-10-6-13-14(7-12(10)16)18-8-17-13/h1-4,6-7,16H,5,8H2 |
| InChIKey | YNTTXUSBGIOAQG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |