C19H13BrO4 — CID 8022199
1-(1,3-benzodioxol-5-yl)-2-(6-bromonaphthalen-2-yl)oxyethanone (PubChem CID 8022199) has the molecular formula C19H13BrO4 and a molecular weight of 385.21 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(6-bromonaphthalen-2-yl)oxyethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(6-bromonaphthalen-2-yl)oxyethanone |
|---|---|
| PubChem CID | 8022199 |
| Molecular Formula | C19H13BrO4 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(6-bromonaphthalen-2-yl)oxyethanone |
| SMILES | O=C(COc1ccc2cc(Br)ccc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H13BrO4/c20-15-4-1-13-8-16(5-2-12(13)7-15)22-10-17(21)14-3-6-18-19(9-14)24-11-23-18/h1-9H,10-11H2 |
| InChIKey | YSJKSIDVJDQFBN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |