C16H13IO4 — CID 7473176
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-iodophenoxy)ethanone (PubChem CID 7473176) has the molecular formula C16H13IO4 and a molecular weight of 396.18 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-iodophenoxy)ethanone.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-iodophenoxy)ethanone |
|---|---|
| PubChem CID | 7473176 |
| Molecular Formula | C16H13IO4 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-iodophenoxy)ethanone |
| SMILES | O=C(COc1ccc(I)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H13IO4/c17-12-2-4-13(5-3-12)21-10-14(18)11-1-6-15-16(9-11)20-8-7-19-15/h1-6,9H,7-8,10H2 |
| InChIKey | TVCIPPWLFYDNTG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|