C18H17IO2 — CID 2953479
2-(4-iodophenoxy)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone (PubChem CID 2953479) has the molecular formula C18H17IO2 and a molecular weight of 392.24 g/mol. Its IUPAC name is 2-(4-iodophenoxy)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone.
| Compound Name | 2-(4-iodophenoxy)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 2953479 |
| Molecular Formula | C18H17IO2 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2-(4-iodophenoxy)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
| SMILES | O=C(COc1ccc(I)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H17IO2/c19-16-7-9-17(10-8-16)21-12-18(20)15-6-5-13-3-1-2-4-14(13)11-15/h5-11H,1-4,12H2 |
| InChIKey | YOFZPAGHEKQDFM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|