C17H12F4O2 — CID 112778139
1-(2,3-dihydro-1H-inden-5-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone (PubChem CID 112778139) has the molecular formula C17H12F4O2 and a molecular weight of 324.27 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
|---|---|
| PubChem CID | 112778139 |
| Molecular Formula | C17H12F4O2 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(2,3,5,6-tetrafluorophenoxy)ethanone |
| SMILES | O=C(COc1c(F)c(F)cc(F)c1F)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H12F4O2/c18-12-7-13(19)16(21)17(15(12)20)23-8-14(22)11-5-4-9-2-1-3-10(9)6-11/h4-7H,1-3,8H2 |
| InChIKey | BTTDHFBBGXKEDK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|