C9H7BrO2 — CID 89293761
6-bromo-2,3-dihydro-1-benzofuran-2-carbaldehyde (PubChem CID 89293761) has the molecular formula C9H7BrO2 and a molecular weight of 227.06 g/mol. Its IUPAC name is 6-bromo-2,3-dihydro-1-benzofuran-2-carbaldehyde.
| Compound Name | 6-bromo-2,3-dihydro-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 89293761 |
| Molecular Formula | C9H7BrO2 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 6-bromo-2,3-dihydro-1-benzofuran-2-carbaldehyde |
| SMILES | O=CC1Cc2ccc(Br)cc2O1 |
| InChI | InChI=1S/C9H7BrO2/c10-7-2-1-6-3-8(5-11)12-9(6)4-7/h1-2,4-5,8H,3H2 |
| InChIKey | XKPFDIIJVOKAKN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|