C8H3BrCl2F2O2 — CID 97109380
(2S,3R)-6-bromo-2,3-dichloro-2,3-difluoro-1,4-benzodioxine (PubChem CID 97109380) has the molecular formula C8H3BrCl2F2O2 and a molecular weight of 319.92 g/mol. Its IUPAC name is (2S,3R)-6-bromo-2,3-dichloro-2,3-difluoro-1,4-benzodioxine.
| Compound Name | (2S,3R)-6-bromo-2,3-dichloro-2,3-difluoro-1,4-benzodioxine |
|---|---|
| PubChem CID | 97109380 |
| Molecular Formula | C8H3BrCl2F2O2 |
| Molecular Weight | 319.92 g/mol |
| Exact Mass | 317.87 |
| IUPAC Name | (2S,3R)-6-bromo-2,3-dichloro-2,3-difluoro-1,4-benzodioxine |
| SMILES | F[C@]1(Cl)Oc2cc(Br)ccc2O[C@@]1(F)Cl |
| InChI | InChI=1S/C8H3BrCl2F2O2/c9-4-1-2-5-6(3-4)15-8(11,13)7(10,12)14-5/h1-3H/t7-,8+/m1/s1 |
| InChIKey | DEVDQAXVEGUCIT-SFYZADRCSA-N |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|