C13H10BrNO4 — CID 168964159
5-(4-bromoanilino)-1,3-benzodioxole-2,2-diol (PubChem CID 168964159) has the molecular formula C13H10BrNO4 and a molecular weight of 324.13 g/mol. Its IUPAC name is 5-(4-bromoanilino)-1,3-benzodioxole-2,2-diol.
| Compound Name | 5-(4-bromoanilino)-1,3-benzodioxole-2,2-diol |
|---|---|
| PubChem CID | 168964159 |
| Molecular Formula | C13H10BrNO4 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 5-(4-bromoanilino)-1,3-benzodioxole-2,2-diol |
| SMILES | OC1(O)Oc2ccc(Nc3ccc(Br)cc3)cc2O1 |
| InChI | InChI=1S/C13H10BrNO4/c14-8-1-3-9(4-2-8)15-10-5-6-11-12(7-10)19-13(16,17)18-11/h1-7,15-17H |
| InChIKey | PDMAHQYBLMYEJY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|