C14H12F2N2O2 — CID 115980643
3-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-methylbenzene-1,3-diamine (PubChem CID 115980643) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-methylbenzene-1,3-diamine.
| Compound Name | 3-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 115980643 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-methylbenzene-1,3-diamine |
| SMILES | Cc1cc(N)cc(Nc2ccc3c(c2)OC(F)(F)O3)c1 |
| InChI | InChI=1S/C14H12F2N2O2/c1-8-4-9(17)6-11(5-8)18-10-2-3-12-13(7-10)20-14(15,16)19-12/h2-7,18H,17H2,1H3 |
| InChIKey | OIFJGWFITDRBSC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|