C13H9BrF2N2O2 — CID 29067009
4-bromo-1-N-(2,2-difluoro-1,3-benzodioxol-5-yl)benzene-1,2-diamine (PubChem CID 29067009) has the molecular formula C13H9BrF2N2O2 and a molecular weight of 343.13 g/mol. Its IUPAC name is 4-bromo-1-N-(2,2-difluoro-1,3-benzodioxol-5-yl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-(2,2-difluoro-1,3-benzodioxol-5-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 29067009 |
| Molecular Formula | C13H9BrF2N2O2 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 4-bromo-1-N-(2,2-difluoro-1,3-benzodioxol-5-yl)benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C13H9BrF2N2O2/c14-7-1-3-10(9(17)5-7)18-8-2-4-11-12(6-8)20-13(15,16)19-11/h1-6,18H,17H2 |
| InChIKey | ZWFKQUGZBDENCX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|