C14H11BrF2N2O2 — CID 130293579
4-bromo-1-N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]benzene-1,2-diamine (PubChem CID 130293579) has the molecular formula C14H11BrF2N2O2 and a molecular weight of 357.15 g/mol. Its IUPAC name is 4-bromo-1-N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 130293579 |
| Molecular Formula | C14H11BrF2N2O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 4-bromo-1-N-[(2,2-difluoro-1,3-benzodioxol-4-yl)methyl]benzene-1,2-diamine |
| SMILES | Nc1cc(Br)ccc1NCc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C14H11BrF2N2O2/c15-9-4-5-11(10(18)6-9)19-7-8-2-1-3-12-13(8)21-14(16,17)20-12/h1-6,19H,7,18H2 |
| InChIKey | YQDZBGUDARQJHA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|